C17H22O7S — CID 137379114
2-(oxan-2-yloxy)ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate (PubChem CID 137379114) has the molecular formula C17H22O7S and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate.
| Compound Name | 2-(oxan-2-yloxy)ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate |
|---|---|
| PubChem CID | 137379114 |
| Molecular Formula | C17H22O7S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(oxan-2-yloxy)ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate |
| SMILES | C=C(OS(=O)(=O)c1ccc(C)cc1)C(=O)OCCOC1CCCCO1 |
| InChI | InChI=1S/C17H22O7S/c1-13-6-8-15(9-7-13)25(19,20)24-14(2)17(18)23-12-11-22-16-5-3-4-10-21-16/h6-9,16H,2-5,10-12H2,1H3 |
| InChIKey | WYOHUSVJMCZMEA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|