C26H30O12S2 — CID 122677510
2-[2-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxy]ethoxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate (PubChem CID 122677510) has the molecular formula C26H30O12S2 and a molecular weight of 598.65 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxy]ethoxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate.
| Compound Name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxy]ethoxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate |
|---|---|
| PubChem CID | 122677510 |
| Molecular Formula | C26H30O12S2 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyprop-2-enoyloxy]ethoxy]ethoxy]ethyl 2-(4-methylphenyl)sulfonyloxyprop-2-enoate |
| SMILES | C=C(OS(=O)(=O)c1ccc(C)cc1)C(=O)OCCOCCOCCOC(=O)C(=C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H30O12S2/c1-19-5-9-23(10-6-19)39(29,30)37-21(3)25(27)35-17-15-33-13-14-34-16-18-36-26(28)22(4)38-40(31,32)24-11-7-20(2)8-12-24/h5-12H,3-4,13-18H2,1-2H3 |
| InChIKey | PXWKSSHXRVWRQL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|