C30H38O11S2 — CID 118650308
2-[2-[2-[2-[2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate (PubChem CID 118650308) has the molecular formula C30H38O11S2 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 118650308 |
| Molecular Formula | C30H38O11S2 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | 2-[2-[2-[2-[2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoyloxy]ethoxy]ethoxy]ethoxy]ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
| SMILES | C=C(CS(=O)(=O)c1ccc(C)cc1)C(=O)OCCOCCOCCOCCOC(=O)C(=C)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H38O11S2/c1-23-5-9-27(10-6-23)42(33,34)21-25(3)29(31)40-19-17-38-15-13-37-14-16-39-18-20-41-30(32)26(4)22-43(35,36)28-11-7-24(2)8-12-28/h5-12H,3-4,13-22H2,1-2H3 |
| InChIKey | BDSPQZRKYYVTIC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|