C26H32BrO9S2- — CID 159316240
ethyl 2-(bromomethyl)prop-2-enoate;ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate;4-methylbenzenesulfonate (PubChem CID 159316240) has the molecular formula C26H32BrO9S2- and a molecular weight of 632.57 g/mol. Its IUPAC name is ethyl 2-(bromomethyl)prop-2-enoate;ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate;4-methylbenzenesulfonate.
| Compound Name | ethyl 2-(bromomethyl)prop-2-enoate;ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159316240 |
| Molecular Formula | C26H32BrO9S2- |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 631.07 |
| IUPAC Name | ethyl 2-(bromomethyl)prop-2-enoate;ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate;4-methylbenzenesulfonate |
| SMILES | C=C(CBr)C(=O)OCC.C=C(CS(=O)(=O)c1ccc(C)cc1)C(=O)OCC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C13H16O4S.C7H8O3S.C6H9BrO2/c1-4-17-13(14)11(3)9-18(15,16)12-7-5-10(2)6-8-12;1-6-2-4-7(5-3-6)11(8,9)10;1-3-9-6(8)5(2)4-7/h5-8H,3-4,9H2,1-2H3;2-5H,1H3,(H,8,9,10);2-4H2,1H3/p-1 |
| InChIKey | WMOCKZUERSBLRN-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 143.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|