C17H24O4S — CID 144994130
2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoic acid;bis(prop-1-ene) (PubChem CID 144994130) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoic acid;bis(prop-1-ene).
| Compound Name | 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoic acid;bis(prop-1-ene) |
|---|---|
| PubChem CID | 144994130 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoic acid;bis(prop-1-ene) |
| SMILES | C=C(CS(=O)(=O)c1ccc(C)cc1)C(=O)O.C=CC.C=CC |
| InChI | InChI=1S/C11H12O4S.2C3H6/c1-8-3-5-10(6-4-8)16(14,15)7-9(2)11(12)13;2*1-3-2/h3-6H,2,7H2,1H3,(H,12,13);2*3H,1H2,2H3 |
| InChIKey | LGOWIXTYVAGSKQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|