C12H12O6S — CID 122231634
2-[2-(4-methylphenyl)sulfonylethylidene]propanedioic acid (PubChem CID 122231634) has the molecular formula C12H12O6S and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)sulfonylethylidene]propanedioic acid.
| Compound Name | 2-[2-(4-methylphenyl)sulfonylethylidene]propanedioic acid |
|---|---|
| PubChem CID | 122231634 |
| Molecular Formula | C12H12O6S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[2-(4-methylphenyl)sulfonylethylidene]propanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)CC=C(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H12O6S/c1-8-2-4-9(5-3-8)19(17,18)7-6-10(11(13)14)12(15)16/h2-6H,7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | GZFFCTCGFBMASZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|