About carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene
carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene (PubChem CID 159550827) has the molecular formula C11H14O5S
and a molecular weight of 258.29 g/mol. Its IUPAC name is carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene.
Molecular Properties
| Compound Name | carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene |
| PubChem CID | 159550827 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene |
| SMILES | C=CCS(=O)(=O)c1ccc(C)cc1.O=C(O)O |
| InChI | InChI=1S/C10H12O2S.CH2O3/c1-3-8-13(11,12)10-6-4-9(2)5-7-10;2-1(3)4/h3-7H,1,8H2,2H3;(H2,2,3,4) |
| InChIKey | MFJGNPDGPWTFPD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene?
The IUPAC name of carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene (CID 159550827) is carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene.
What is the SMILES notation for carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene?
The canonical SMILES for carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene is C=CCS(=O)(=O)c1ccc(C)cc1.O=C(O)O.
What is the InChIKey of carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene?
The InChIKey is MFJGNPDGPWTFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S.CH2O3/c1-3-8-13(11,12)10-6-4-9(2)5-7-10;2-1(3)4/h3-7H,1,8H2,2H3;(H2,2,3,4).
What are the key properties of carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene?
carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene has a molecular weight of 258.29 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-methyl-4-prop-2-enylsulfonylbenzene is sourced from PubChem (CID 159550827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).