About fluorobenzene;prop-2-enylsulfonylbenzene
fluorobenzene;prop-2-enylsulfonylbenzene (PubChem CID 174649158) has the molecular formula C15H15FO2S
and a molecular weight of 278.35 g/mol. Its IUPAC name is fluorobenzene;prop-2-enylsulfonylbenzene.
Molecular Properties
| Compound Name | fluorobenzene;prop-2-enylsulfonylbenzene |
| PubChem CID | 174649158 |
| Molecular Formula | C15H15FO2S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | fluorobenzene;prop-2-enylsulfonylbenzene |
| SMILES | C=CCS(=O)(=O)c1ccccc1.Fc1ccccc1 |
| InChI | InChI=1S/C9H10O2S.C6H5F/c1-2-8-12(10,11)9-6-4-3-5-7-9;7-6-4-2-1-3-5-6/h2-7H,1,8H2;1-5H |
| InChIKey | UTASFMHYCNATRA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;prop-2-enylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;prop-2-enylsulfonylbenzene?
The IUPAC name of fluorobenzene;prop-2-enylsulfonylbenzene (CID 174649158) is fluorobenzene;prop-2-enylsulfonylbenzene.
What is the SMILES notation for fluorobenzene;prop-2-enylsulfonylbenzene?
The canonical SMILES for fluorobenzene;prop-2-enylsulfonylbenzene is C=CCS(=O)(=O)c1ccccc1.Fc1ccccc1.
What is the InChIKey of fluorobenzene;prop-2-enylsulfonylbenzene?
The InChIKey is UTASFMHYCNATRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S.C6H5F/c1-2-8-12(10,11)9-6-4-3-5-7-9;7-6-4-2-1-3-5-6/h2-7H,1,8H2;1-5H.
What are the key properties of fluorobenzene;prop-2-enylsulfonylbenzene?
fluorobenzene;prop-2-enylsulfonylbenzene has a molecular weight of 278.35 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;prop-2-enylsulfonylbenzene is sourced from PubChem (CID 174649158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).