C15H20O2S — CID 15195507
4,5,5-trimethylhexa-2,3-dienylsulfonylbenzene (PubChem CID 15195507) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 4,5,5-trimethylhexa-2,3-dienylsulfonylbenzene.
| Compound Name | 4,5,5-trimethylhexa-2,3-dienylsulfonylbenzene |
|---|---|
| PubChem CID | 15195507 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4,5,5-trimethylhexa-2,3-dienylsulfonylbenzene |
| SMILES | CC(=C=CCS(=O)(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H20O2S/c1-13(15(2,3)4)9-8-12-18(16,17)14-10-6-5-7-11-14/h5-8,10-11H,12H2,1-4H3 |
| InChIKey | KVQDJBHJDTVUHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |