C18H18O2S — CID 73004123
[5-(benzenesulfonyl)-3-methylpenta-1,3-dienyl]benzene (PubChem CID 73004123) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-3-methylpenta-1,3-dienyl]benzene.
| Compound Name | [5-(benzenesulfonyl)-3-methylpenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 73004123 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [5-(benzenesulfonyl)-3-methylpenta-1,3-dienyl]benzene |
| SMILES | CC(C=Cc1ccccc1)=CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O2S/c1-16(12-13-17-8-4-2-5-9-17)14-15-21(19,20)18-10-6-3-7-11-18/h2-14H,15H2,1H3 |
| InChIKey | MMDBXSJRLWVNIO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|