C25H24O6S3 — CID 17373692
[(2E)-3,4-bis(benzenesulfonyl)-5-methylhexa-2,4-dienyl]sulfonylbenzene (PubChem CID 17373692) has the molecular formula C25H24O6S3 and a molecular weight of 516.66 g/mol. Its IUPAC name is [(2E)-3,4-bis(benzenesulfonyl)-5-methylhexa-2,4-dienyl]sulfonylbenzene.
| Compound Name | [(2E)-3,4-bis(benzenesulfonyl)-5-methylhexa-2,4-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 17373692 |
| Molecular Formula | C25H24O6S3 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | [(2E)-3,4-bis(benzenesulfonyl)-5-methylhexa-2,4-dienyl]sulfonylbenzene |
| SMILES | CC(C)=C(/C(=C\CS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24O6S3/c1-20(2)25(34(30,31)23-16-10-5-11-17-23)24(33(28,29)22-14-8-4-9-15-22)18-19-32(26,27)21-12-6-3-7-13-21/h3-18H,19H2,1-2H3/b24-18+ |
| InChIKey | OWVPCZCFSPTKDR-HKOYGPOVSA-N |
| XLogP | 4.59 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|