C18H26O3S — CID 71349271
10-(benzenesulfonyl)-4,8-dimethyldeca-4,8-dien-1-ol (PubChem CID 71349271) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-4,8-dimethyldeca-4,8-dien-1-ol.
| Compound Name | 10-(benzenesulfonyl)-4,8-dimethyldeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 71349271 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 10-(benzenesulfonyl)-4,8-dimethyldeca-4,8-dien-1-ol |
| SMILES | CC(=CCS(=O)(=O)c1ccccc1)CCC=C(C)CCCO |
| InChI | InChI=1S/C18H26O3S/c1-16(10-7-14-19)8-6-9-17(2)13-15-22(20,21)18-11-4-3-5-12-18/h3-5,8,11-13,19H,6-7,9-10,14-15H2,1-2H3 |
| InChIKey | ROLUSSHOGVADRE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|