C16H22O — CID 15380841
(2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dien-1-ol (PubChem CID 15380841) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 15380841 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)Cc1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-14(11-12-17)7-6-8-15(2)13-16-9-4-3-5-10-16/h3-5,8-11,17H,6-7,12-13H2,1-2H3/b14-11+,15-8+ |
| InChIKey | GMPPUWZTZSUDPV-GGQZXFEVSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|