C20H24O — CID 122186589
(2E,6E)-3,7-dimethyl-8-naphthalen-2-ylocta-2,6-dien-1-ol (PubChem CID 122186589) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-8-naphthalen-2-ylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-3,7-dimethyl-8-naphthalen-2-ylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 122186589 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-8-naphthalen-2-ylocta-2,6-dien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24O/c1-16(12-13-21)6-5-7-17(2)14-18-10-11-19-8-3-4-9-20(19)15-18/h3-4,7-12,15,21H,5-6,13-14H2,1-2H3/b16-12+,17-7+ |
| InChIKey | KCSRSKCDPUXSLM-ALUFRLKHSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|