C17H26O3 — CID 174793032
(2E)-3,7-dimethylocta-2,6-dien-1-ol;2-methoxyphenol (PubChem CID 174793032) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;2-methoxyphenol.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;2-methoxyphenol |
|---|---|
| PubChem CID | 174793032 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;2-methoxyphenol |
| SMILES | CC(C)=CCC/C(C)=C/CO.COc1ccccc1O |
| InChI | InChI=1S/C10H18O.C7H8O2/c1-9(2)5-4-6-10(3)7-8-11;1-9-7-5-3-2-4-6(7)8/h5,7,11H,4,6,8H2,1-3H3;2-5,8H,1H3/b10-7+; |
| InChIKey | PSCOMYBVDNQTDI-HCUGZAAXSA-N |
| XLogP | 4.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|