C23H26N2O2 — CID 162858744
1-(3,7-dimethylocta-2,6-dienoxy)-6-methoxyphenazine (PubChem CID 162858744) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(3,7-dimethylocta-2,6-dienoxy)-6-methoxyphenazine.
| Compound Name | 1-(3,7-dimethylocta-2,6-dienoxy)-6-methoxyphenazine |
|---|---|
| PubChem CID | 162858744 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(3,7-dimethylocta-2,6-dienoxy)-6-methoxyphenazine |
| SMILES | COc1cccc2nc3c(OCC=C(C)CCC=C(C)C)cccc3nc12 |
| InChI | InChI=1S/C23H26N2O2/c1-16(2)8-5-9-17(3)14-15-27-21-13-7-11-19-23(21)25-18-10-6-12-20(26-4)22(18)24-19/h6-8,10-14H,5,9,15H2,1-4H3 |
| InChIKey | AYBXOQNDOSRELU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|