C20H28O5 — CID 25066806
methoxymethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxybenzoate (PubChem CID 25066806) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is methoxymethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxybenzoate.
| Compound Name | methoxymethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxybenzoate |
|---|---|
| PubChem CID | 25066806 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methoxymethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxybenzoate |
| SMILES | COCOC(=O)c1ccc(OC)c(OC/C=C(\C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C20H28O5/c1-15(2)7-6-8-16(3)11-12-24-19-13-17(9-10-18(19)23-5)20(21)25-14-22-4/h7,9-11,13H,6,8,12,14H2,1-5H3/b16-11+ |
| InChIKey | BVRLQRNHXCEERL-LFIBNONCSA-N |
| XLogP | 4.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|