C26H29FO3 — CID 139593936
(E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyphenyl]-3-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 139593936) has the molecular formula C26H29FO3 and a molecular weight of 408.51 g/mol. Its IUPAC name is (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyphenyl]-3-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyphenyl]-3-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139593936 |
| Molecular Formula | C26H29FO3 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyphenyl]-3-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2cccc(F)c2)ccc1OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H29FO3/c1-19(2)7-5-8-20(3)15-16-30-25-14-12-22(18-26(25)29-4)24(28)13-11-21-9-6-10-23(27)17-21/h6-7,9-15,17-18H,5,8,16H2,1-4H3/b13-11+,20-15+ |
| InChIKey | LWVLKXMCFMGEMH-PZBCRXGTSA-N |
| XLogP | 6.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|