C25H34O4 — CID 161410102
(E)-3-[3-methoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]prop-2-enoic acid (PubChem CID 161410102) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 161410102 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (E)-3-[3-methoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1OCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H34O4/c1-19(2)8-6-9-20(3)10-7-11-21(4)16-17-29-23-14-12-22(13-15-25(26)27)18-24(23)28-5/h8,10,12-16,18H,6-7,9,11,17H2,1-5H3,(H,26,27)/b15-13+,20-10?,21-16? |
| InChIKey | VVIUHQGIDBFRLY-ZNNIDLBHSA-N |
| XLogP | 6.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|