C21H28O4 — CID 14484652
(E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 14484652) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 14484652 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(C/C=C(\C)CCC=C(C)C)c1OC |
| InChI | InChI=1S/C21H28O4/c1-15(2)7-6-8-16(3)9-11-18-13-17(10-12-20(22)23)14-19(24-4)21(18)25-5/h7,9-10,12-14H,6,8,11H2,1-5H3,(H,22,23)/b12-10+,16-9+ |
| InChIKey | IXDDIYJCTLFLLS-BVXVVYCSSA-N |
| XLogP | 5.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|