C28H34O4 — CID 118730771
(E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dimethoxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 118730771) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dimethoxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dimethoxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118730771 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dimethoxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(C/C=C(\C)CCC=C(C)C)c2OC)cc1 |
| InChI | InChI=1S/C28H34O4/c1-20(2)8-7-9-21(3)10-16-25-27(31-5)19-17-24(28(25)32-6)26(29)18-13-22-11-14-23(30-4)15-12-22/h8,10-15,17-19H,7,9,16H2,1-6H3/b18-13+,21-10+ |
| InChIKey | DYAMLAYKVSKXNZ-MHQDQBLBSA-N |
| XLogP | 6.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|