C20H26O3 — CID 5373772
[(2E)-3,7-dimethylocta-2,6-dienyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 5373772) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5373772 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C20H26O3/c1-16(2)6-5-7-17(3)14-15-23-20(21)13-10-18-8-11-19(22-4)12-9-18/h6,8-14H,5,7,15H2,1-4H3/b13-10+,17-14+ |
| InChIKey | YIFWVHUHLSWZDV-OZZAOFPBSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|