C30H34O5 — CID 102235908
7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,8-dimethoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]isochromen-1-one (PubChem CID 102235908) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,8-dimethoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]isochromen-1-one.
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,8-dimethoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]isochromen-1-one |
|---|---|
| PubChem CID | 102235908 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,8-dimethoxy-3-[(E)-2-(4-methoxyphenyl)ethenyl]isochromen-1-one |
| SMILES | COc1ccc(/C=C/c2cc3cc(OC)c(C/C=C(\C)CCC=C(C)C)c(OC)c3c(=O)o2)cc1 |
| InChI | InChI=1S/C30H34O5/c1-20(2)8-7-9-21(3)10-17-26-27(33-5)19-23-18-25(35-30(31)28(23)29(26)34-6)16-13-22-11-14-24(32-4)15-12-22/h8,10-16,18-19H,7,9,17H2,1-6H3/b16-13+,21-10+ |
| InChIKey | IHWBOFCYOIWPBX-JYYKFOSMSA-N |
| XLogP | 7.22 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|