C21H24O6 — CID 174454294
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxy-2-oxochromene-6-carboxylic acid (PubChem CID 174454294) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxy-2-oxochromene-6-carboxylic acid.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxy-2-oxochromene-6-carboxylic acid |
|---|---|
| PubChem CID | 174454294 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxy-2-oxochromene-6-carboxylic acid |
| SMILES | COc1c(C(=O)O)ccc2oc(=O)c(C/C=C(\C)CCC=C(C)C)c(O)c12 |
| InChI | InChI=1S/C21H24O6/c1-12(2)6-5-7-13(3)8-9-14-18(22)17-16(27-21(14)25)11-10-15(20(23)24)19(17)26-4/h6,8,10-11,22H,5,7,9H2,1-4H3,(H,23,24)/b13-8+ |
| InChIKey | MNPXMWYGBUJFCM-MDWZMJQESA-N |
| XLogP | 4.44 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|