C48H58O7 — CID 162847661
4-hydroxy-3-[12-[(5S)-1-(4-hydroxy-2-oxochromen-3-yl)-3,7,11-trimethyldodeca-2,6,10-trien-5-yl]oxy-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one (PubChem CID 162847661) has the molecular formula C48H58O7 and a molecular weight of 746.99 g/mol. Its IUPAC name is 4-hydroxy-3-[12-[(5S)-1-(4-hydroxy-2-oxochromen-3-yl)-3,7,11-trimethyldodeca-2,6,10-trien-5-yl]oxy-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[12-[(5S)-1-(4-hydroxy-2-oxochromen-3-yl)-3,7,11-trimethyldodeca-2,6,10-trien-5-yl]oxy-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one |
|---|---|
| PubChem CID | 162847661 |
| Molecular Formula | C48H58O7 |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.42 |
| IUPAC Name | 4-hydroxy-3-[12-[(5S)-1-(4-hydroxy-2-oxochromen-3-yl)-3,7,11-trimethyldodeca-2,6,10-trien-5-yl]oxy-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one |
| SMILES | CC(C)=CCCC(C)=C[C@H](CC(C)=CCc1c(O)c2ccccc2oc1=O)OCC(C)=CCCC(C)=CCCC(C)=CCc1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C48H58O7/c1-32(2)15-12-19-35(5)29-38(30-36(6)26-28-42-46(50)40-22-9-11-24-44(40)55-48(42)52)53-31-37(7)20-14-17-33(3)16-13-18-34(4)25-27-41-45(49)39-21-8-10-23-43(39)54-47(41)51/h8-11,15-16,20-26,29,38,49-50H,12-14,17-19,27-28,30-31H2,1-7H3/t38-/m1/s1 |
| InChIKey | DZZBDBJVZYCYGH-KXQOOQHDSA-N |
| XLogP | 11.91 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|