C22H26O6 — CID 174454299
2-hydroxyethyl 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-oxochromene-6-carboxylate (PubChem CID 174454299) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 2-hydroxyethyl 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-oxochromene-6-carboxylate.
| Compound Name | 2-hydroxyethyl 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-oxochromene-6-carboxylate |
|---|---|
| PubChem CID | 174454299 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-hydroxyethyl 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-oxochromene-6-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)c2cc(C(=O)OCCO)ccc2oc1=O |
| InChI | InChI=1S/C22H26O6/c1-14(2)5-4-6-15(3)7-9-17-20(24)18-13-16(21(25)27-12-11-23)8-10-19(18)28-22(17)26/h5,7-8,10,13,23-24H,4,6,9,11-12H2,1-3H3/b15-7+ |
| InChIKey | GOTZAJZDKHWBMU-VIZOYTHASA-N |
| XLogP | 3.88 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|