C32H36O7 — CID 53355126
[6-acetyloxy-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-hydroxy-7-(3-methylbut-2-enyl)-9-oxoxanthen-2-yl] acetate (PubChem CID 53355126) has the molecular formula C32H36O7 and a molecular weight of 532.63 g/mol. Its IUPAC name is [6-acetyloxy-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-hydroxy-7-(3-methylbut-2-enyl)-9-oxoxanthen-2-yl] acetate.
| Compound Name | [6-acetyloxy-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-hydroxy-7-(3-methylbut-2-enyl)-9-oxoxanthen-2-yl] acetate |
|---|---|
| PubChem CID | 53355126 |
| Molecular Formula | C32H36O7 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | [6-acetyloxy-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-hydroxy-7-(3-methylbut-2-enyl)-9-oxoxanthen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2oc3c(C/C=C(\C)CCC=C(C)C)c(OC(C)=O)c(CC=C(C)C)c(O)c3c(=O)c2c1 |
| InChI | InChI=1S/C32H36O7/c1-18(2)9-8-10-20(5)12-15-25-31(38-22(7)34)24(14-11-19(3)4)29(35)28-30(36)26-17-23(37-21(6)33)13-16-27(26)39-32(25)28/h9,11-13,16-17,35H,8,10,14-15H2,1-7H3/b20-12+ |
| InChIKey | PKXJDDMCXDGNNA-UDWIEESQSA-N |
| XLogP | 7.25 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|