C28H32O6 — CID 176514014
1,3,7-trihydroxy-4-[(2E,6S)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2-(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 176514014) has the molecular formula C28H32O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is 1,3,7-trihydroxy-4-[(2E,6S)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2-(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 1,3,7-trihydroxy-4-[(2E,6S)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2-(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 176514014 |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1,3,7-trihydroxy-4-[(2E,6S)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-2-(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | C=C(C)[C@@H](O)CC/C(C)=C/Cc1c(O)c(CC=C(C)C)c(O)c2c(=O)c3cc(O)ccc3oc12 |
| InChI | InChI=1S/C28H32O6/c1-15(2)6-10-19-25(31)20(11-7-17(5)8-12-22(30)16(3)4)28-24(26(19)32)27(33)21-14-18(29)9-13-23(21)34-28/h6-7,9,13-14,22,29-32H,3,8,10-12H2,1-2,4-5H3/b17-7+/t22-/m0/s1 |
| InChIKey | OKAKHZYIGPWLSK-YRNBWCPGSA-N |
| XLogP | 5.78 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|