C18H16O5 — CID 26250237
1,3,6-trihydroxy-2-(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 26250237) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 1,3,6-trihydroxy-2-(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 1,3,6-trihydroxy-2-(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 26250237 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1,3,6-trihydroxy-2-(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | CC(C)=CCc1c(O)cc2oc3cc(O)ccc3c(=O)c2c1O |
| InChI | InChI=1S/C18H16O5/c1-9(2)3-5-11-13(20)8-15-16(17(11)21)18(22)12-6-4-10(19)7-14(12)23-15/h3-4,6-8,19-21H,5H2,1-2H3 |
| InChIKey | BUVGSDAKOBKGFK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|