C20H16O6 — CID 14309761
1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one (PubChem CID 14309761) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one.
| Compound Name | 1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one |
|---|---|
| PubChem CID | 14309761 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one |
| SMILES | CC(C)=CCc1c(O)cc2oc3oc4cc(O)ccc4c3c(=O)c2c1O |
| InChI | InChI=1S/C20H16O6/c1-9(2)3-5-11-13(22)8-15-17(18(11)23)19(24)16-12-6-4-10(21)7-14(12)25-20(16)26-15/h3-4,6-8,21-23H,5H2,1-2H3 |
| InChIKey | NOYRXEKDLRHOOL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|