C19H18O6 — CID 14886043
1,3,6-trihydroxy-5-methoxy-2-(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 14886043) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1,3,6-trihydroxy-5-methoxy-2-(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 1,3,6-trihydroxy-5-methoxy-2-(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 14886043 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1,3,6-trihydroxy-5-methoxy-2-(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | COc1c(O)ccc2c(=O)c3c(O)c(CC=C(C)C)c(O)cc3oc12 |
| InChI | InChI=1S/C19H18O6/c1-9(2)4-5-10-13(21)8-14-15(16(10)22)17(23)11-6-7-12(20)19(24-3)18(11)25-14/h4,6-8,20-22H,5H2,1-3H3 |
| InChIKey | HYBKBBVYRCBCKS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|