C26H28O7 — CID 162944028
2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3,6-bis(3-methylbut-2-enyl)chromen-4-one (PubChem CID 162944028) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3,6-bis(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3,6-bis(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 162944028 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3,6-bis(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1cc(O)c(O)cc1-c1oc2cc(O)c(CC=C(C)C)c(O)c2c(=O)c1CC=C(C)C |
| InChI | InChI=1S/C26H28O7/c1-13(2)6-8-15-18(27)11-22-23(24(15)30)25(31)16(9-7-14(3)4)26(33-22)17-10-19(28)20(29)12-21(17)32-5/h6-7,10-12,27-30H,8-9H2,1-5H3 |
| InChIKey | SAYLVVWOWASTOM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|