C28H35NO6 — CID 10050886
6-[2-(dimethylamino)ethoxy]-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 10050886) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethoxy]-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 6-[2-(dimethylamino)ethoxy]-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 10050886 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 6-[2-(dimethylamino)ethoxy]-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | COc1c(OCCN(C)C)cc2oc3cc(O)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C28H35NO6/c1-16(2)8-10-18-20(30)14-21-25(26(18)31)27(32)24-19(11-9-17(3)4)28(33-7)23(15-22(24)35-21)34-13-12-29(5)6/h8-9,14-15,30-31H,10-13H2,1-7H3 |
| InChIKey | MYUIOSPKBTYFRG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|