C30H36Br2O6 — CID 71515803
3,6-bis(3-bromopropoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 71515803) has the molecular formula C30H36Br2O6 and a molecular weight of 652.42 g/mol. Its IUPAC name is 3,6-bis(3-bromopropoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 3,6-bis(3-bromopropoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 71515803 |
| Molecular Formula | C30H36Br2O6 |
| Molecular Weight | 652.42 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | 3,6-bis(3-bromopropoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | COc1c(OCCCBr)cc2oc3cc(OCCCBr)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C30H36Br2O6/c1-18(2)8-10-20-22(36-14-6-12-31)16-24-27(28(20)33)29(34)26-21(11-9-19(3)4)30(35-5)25(17-23(26)38-24)37-15-7-13-32/h8-9,16-17,33H,6-7,10-15H2,1-5H3 |
| InChIKey | MJPOCJAZSVZWHZ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.42 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|