C27H32O6 — CID 144550277
1,6-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3-propoxyxanthen-9-one (PubChem CID 144550277) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is 1,6-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3-propoxyxanthen-9-one.
| Compound Name | 1,6-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3-propoxyxanthen-9-one |
|---|---|
| PubChem CID | 144550277 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1,6-dihydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-3-propoxyxanthen-9-one |
| SMILES | CCCOc1cc2oc3cc(O)c(OC)c(CC=C(C)C)c3c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C27H32O6/c1-7-12-32-20-14-22-24(25(29)17(20)10-8-15(2)3)26(30)23-18(11-9-16(4)5)27(31-6)19(28)13-21(23)33-22/h8-9,13-14,28-29H,7,10-12H2,1-6H3 |
| InChIKey | XQROYZWAAMEZAF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|