C28H32Br2O6 — CID 71515802
3,6-bis(2-bromoethoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 71515802) has the molecular formula C28H32Br2O6 and a molecular weight of 624.37 g/mol. Its IUPAC name is 3,6-bis(2-bromoethoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 3,6-bis(2-bromoethoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 71515802 |
| Molecular Formula | C28H32Br2O6 |
| Molecular Weight | 624.37 g/mol |
| Exact Mass | 622.06 |
| IUPAC Name | 3,6-bis(2-bromoethoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | COc1c(OCCBr)cc2oc3cc(OCCBr)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C28H32Br2O6/c1-16(2)6-8-18-20(34-12-10-29)14-22-25(26(18)31)27(32)24-19(9-7-17(3)4)28(33-5)23(35-13-11-30)15-21(24)36-22/h6-7,14-15,31H,8-13H2,1-5H3 |
| InChIKey | QQQYHQJQXVLXDP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.37 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|