C48H60N2O6 — CID 127035615
3,6-bis[4-[benzyl(methyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 127035615) has the molecular formula C48H60N2O6 and a molecular weight of 761.02 g/mol. Its IUPAC name is 3,6-bis[4-[benzyl(methyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 3,6-bis[4-[benzyl(methyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 127035615 |
| Molecular Formula | C48H60N2O6 |
| Molecular Weight | 761.02 g/mol |
| Exact Mass | 760.45 |
| IUPAC Name | 3,6-bis[4-[benzyl(methyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | COc1c(OCCCCN(C)Cc2ccccc2)cc2oc3cc(OCCCCN(C)Cc4ccccc4)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C48H60N2O6/c1-34(2)22-24-38-40(54-28-16-14-26-49(5)32-36-18-10-8-11-19-36)30-42-45(46(38)51)47(52)44-39(25-23-35(3)4)48(53-7)43(31-41(44)56-42)55-29-17-15-27-50(6)33-37-20-12-9-13-21-37/h8-13,18-23,30-31,51H,14-17,24-29,32-33H2,1-7H3 |
| InChIKey | PVSJXUQVWOEDCG-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.02 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|