C42H44N2O8 — CID 170857738
[6-[(2R)-2-amino-3-phenylpropanoyl]oxy-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl] 2-amino-3-phenylpropanoate (PubChem CID 170857738) has the molecular formula C42H44N2O8 and a molecular weight of 704.82 g/mol. Its IUPAC name is [6-[(2R)-2-amino-3-phenylpropanoyl]oxy-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl] 2-amino-3-phenylpropanoate.
| Compound Name | [6-[(2R)-2-amino-3-phenylpropanoyl]oxy-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl] 2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 170857738 |
| Molecular Formula | C42H44N2O8 |
| Molecular Weight | 704.82 g/mol |
| Exact Mass | 704.31 |
| IUPAC Name | [6-[(2R)-2-amino-3-phenylpropanoyl]oxy-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl] 2-amino-3-phenylpropanoate |
| SMILES | COc1c(OC(=O)[C@H](N)Cc2ccccc2)cc2oc3cc(OC(=O)C(N)Cc4ccccc4)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C42H44N2O8/c1-24(2)16-18-28-32(51-41(47)30(43)20-26-12-8-6-9-13-26)22-34-37(38(28)45)39(46)36-29(19-17-25(3)4)40(49-5)35(23-33(36)50-34)52-42(48)31(44)21-27-14-10-7-11-15-27/h6-17,22-23,30-31,45H,18-21,43-44H2,1-5H3/t30?,31-/m1/s1 |
| InChIKey | NBCMAGNHKQUPHL-NLIBRCFJSA-N |
| XLogP | 6.63 |
| TPSA | 164.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.82 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|