C38H56N6O6 — CID 71515902
2-[6-[6-[6-(diaminomethylideneamino)hexoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexyl]guanidine (PubChem CID 71515902) has the molecular formula C38H56N6O6 and a molecular weight of 692.90 g/mol. Its IUPAC name is 2-[6-[6-[6-(diaminomethylideneamino)hexoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexyl]guanidine.
| Compound Name | 2-[6-[6-[6-(diaminomethylideneamino)hexoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexyl]guanidine |
|---|---|
| PubChem CID | 71515902 |
| Molecular Formula | C38H56N6O6 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.43 |
| IUPAC Name | 2-[6-[6-[6-(diaminomethylideneamino)hexoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexyl]guanidine |
| SMILES | COc1c(OCCCCCCN=C(N)N)cc2oc3cc(OCCCCCCN=C(N)N)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C38H56N6O6/c1-24(2)14-16-26-28(48-20-12-8-6-10-18-43-37(39)40)22-30-33(34(26)45)35(46)32-27(17-15-25(3)4)36(47-5)31(23-29(32)50-30)49-21-13-9-7-11-19-44-38(41)42/h14-15,22-23,45H,6-13,16-21H2,1-5H3,(H4,39,40,43)(H4,41,42,44) |
| InChIKey | IUMRYFJWULBDMB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 206.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|