C40H60N2O8 — CID 127035435
3,6-bis[4-[ethyl(2-hydroxyethyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 127035435) has the molecular formula C40H60N2O8 and a molecular weight of 696.93 g/mol. Its IUPAC name is 3,6-bis[4-[ethyl(2-hydroxyethyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 3,6-bis[4-[ethyl(2-hydroxyethyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 127035435 |
| Molecular Formula | C40H60N2O8 |
| Molecular Weight | 696.93 g/mol |
| Exact Mass | 696.43 |
| IUPAC Name | 3,6-bis[4-[ethyl(2-hydroxyethyl)amino]butoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | CCN(CCO)CCCCOc1cc2oc3cc(OCCCCN(CC)CCO)c(OC)c(CC=C(C)C)c3c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C40H60N2O8/c1-8-41(20-22-43)18-10-12-24-48-32-26-34-37(38(45)30(32)16-14-28(3)4)39(46)36-31(17-15-29(5)6)40(47-7)35(27-33(36)50-34)49-25-13-11-19-42(9-2)21-23-44/h14-15,26-27,43-45H,8-13,16-25H2,1-7H3 |
| InChIKey | TZQPFTOUTOOJOI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.93 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|