C42H54O8 — CID 89435708
1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-6-[4-[(2E)-penta-2,4-dien-2-yl]oxybutoxy]-3-[4-[(3Z)-penta-1,3-dien-2-yl]oxybutoxy]xanthen-9-one (PubChem CID 89435708) has the molecular formula C42H54O8 and a molecular weight of 686.89 g/mol. Its IUPAC name is 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-6-[4-[(2E)-penta-2,4-dien-2-yl]oxybutoxy]-3-[4-[(3Z)-penta-1,3-dien-2-yl]oxybutoxy]xanthen-9-one.
| Compound Name | 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-6-[4-[(2E)-penta-2,4-dien-2-yl]oxybutoxy]-3-[4-[(3Z)-penta-1,3-dien-2-yl]oxybutoxy]xanthen-9-one |
|---|---|
| PubChem CID | 89435708 |
| Molecular Formula | C42H54O8 |
| Molecular Weight | 686.89 g/mol |
| Exact Mass | 686.38 |
| IUPAC Name | 1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-6-[4-[(2E)-penta-2,4-dien-2-yl]oxybutoxy]-3-[4-[(3Z)-penta-1,3-dien-2-yl]oxybutoxy]xanthen-9-one |
| SMILES | C=C/C=C(\C)OCCCCOc1cc2oc3cc(OCCCCOC(=C)/C=C\C)c(CC=C(C)C)c(O)c3c(=O)c2c(CC=C(C)C)c1OC |
| InChI | InChI=1S/C42H54O8/c1-10-16-30(7)46-22-12-14-24-48-34-26-36-39(40(43)32(34)20-18-28(3)4)41(44)38-33(21-19-29(5)6)42(45-9)37(27-35(38)50-36)49-25-15-13-23-47-31(8)17-11-2/h10-11,16-19,26-27,43H,2,7,12-15,20-25H2,1,3-6,8-9H3/b16-10-,31-17+ |
| InChIKey | SETHFKUQIUVBHW-LLWWYYPFSA-N |
| XLogP | 10.21 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.89 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|