C36H52N6O6 — CID 71516412
2-[5-[6-[5-(diaminomethylideneamino)pentoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxypentyl]guanidine (PubChem CID 71516412) has the molecular formula C36H52N6O6 and a molecular weight of 664.85 g/mol. Its IUPAC name is 2-[5-[6-[5-(diaminomethylideneamino)pentoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxypentyl]guanidine.
| Compound Name | 2-[5-[6-[5-(diaminomethylideneamino)pentoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxypentyl]guanidine |
|---|---|
| PubChem CID | 71516412 |
| Molecular Formula | C36H52N6O6 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.39 |
| IUPAC Name | 2-[5-[6-[5-(diaminomethylideneamino)pentoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxypentyl]guanidine |
| SMILES | COc1c(OCCCCCN=C(N)N)cc2oc3cc(OCCCCCN=C(N)N)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C36H52N6O6/c1-22(2)12-14-24-26(46-18-10-6-8-16-41-35(37)38)20-28-31(32(24)43)33(44)30-25(15-13-23(3)4)34(45-5)29(21-27(30)48-28)47-19-11-7-9-17-42-36(39)40/h12-13,20-21,43H,6-11,14-19H2,1-5H3,(H4,37,38,41)(H4,39,40,42) |
| InChIKey | KMRFCGHOQBTFDU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 206.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|