C21H20O6 — CID 162859073
5,7-dihydroxy-2-(4-hydroxy-2-methoxyphenyl)-3-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 162859073) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxy-2-methoxyphenyl)-3-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxy-2-methoxyphenyl)-3-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 162859073 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-2-methoxyphenyl)-3-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1cc(O)ccc1-c1oc2cc(O)cc(O)c2c(=O)c1CC=C(C)C |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-6-15-20(25)19-16(24)8-13(23)10-18(19)27-21(15)14-7-5-12(22)9-17(14)26-3/h4-5,7-10,22-24H,6H2,1-3H3 |
| InChIKey | QWUWEVIBWLBNJT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|