C26H28O7 — CID 53363478
2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dihydroxyphenyl]-5,7-dihydroxy-3-methoxychromen-4-one (PubChem CID 53363478) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dihydroxyphenyl]-5,7-dihydroxy-3-methoxychromen-4-one.
| Compound Name | 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dihydroxyphenyl]-5,7-dihydroxy-3-methoxychromen-4-one |
|---|---|
| PubChem CID | 53363478 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dihydroxyphenyl]-5,7-dihydroxy-3-methoxychromen-4-one |
| SMILES | COc1c(-c2ccc(O)c(O)c2C/C=C(\C)CCC=C(C)C)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C26H28O7/c1-14(2)6-5-7-15(3)8-9-17-18(10-11-19(28)23(17)30)25-26(32-4)24(31)22-20(29)12-16(27)13-21(22)33-25/h6,8,10-13,27-30H,5,7,9H2,1-4H3/b15-8+ |
| InChIKey | AGJPGVFVAYNHMZ-OVCLIPMQSA-N |
| XLogP | 5.53 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|