C23H24O6 — CID 171922205
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,6-tetrahydroxyxanthen-9-one (PubChem CID 171922205) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,6-tetrahydroxyxanthen-9-one.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,6-tetrahydroxyxanthen-9-one |
|---|---|
| PubChem CID | 171922205 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,6-tetrahydroxyxanthen-9-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc2oc3c(O)c(O)ccc3c(=O)c2c1O |
| InChI | InChI=1S/C23H24O6/c1-12(2)5-4-6-13(3)7-8-14-17(25)11-18-19(20(14)26)21(27)15-9-10-16(24)22(28)23(15)29-18/h5,7,9-11,24-26,28H,4,6,8H2,1-3H3/b13-7+ |
| InChIKey | ILUSTFKAHDXRAX-NTUHNPAUSA-N |
| XLogP | 5.00 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|