C29H36O7 — CID 73119405
1-(3,7-dimethylocta-2,6-dienyl)-3,6,8-trihydroxy-7-(3-hydroxy-3-methylbutyl)-2-methoxyxanthen-9-one (PubChem CID 73119405) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is 1-(3,7-dimethylocta-2,6-dienyl)-3,6,8-trihydroxy-7-(3-hydroxy-3-methylbutyl)-2-methoxyxanthen-9-one.
| Compound Name | 1-(3,7-dimethylocta-2,6-dienyl)-3,6,8-trihydroxy-7-(3-hydroxy-3-methylbutyl)-2-methoxyxanthen-9-one |
|---|---|
| PubChem CID | 73119405 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 1-(3,7-dimethylocta-2,6-dienyl)-3,6,8-trihydroxy-7-(3-hydroxy-3-methylbutyl)-2-methoxyxanthen-9-one |
| SMILES | COc1c(O)cc2oc3cc(O)c(CCC(C)(C)O)c(O)c3c(=O)c2c1CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C29H36O7/c1-16(2)8-7-9-17(3)10-11-19-24-22(15-21(31)28(19)35-6)36-23-14-20(30)18(12-13-29(4,5)34)26(32)25(23)27(24)33/h8,10,14-15,30-32,34H,7,9,11-13H2,1-6H3 |
| InChIKey | RJQKCIQZFYHTRJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|