C24H28O9 — CID 102228587
2-(2,3-dihydroxy-3-methylbutyl)-1,3,6-trihydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxyxanthen-9-one (PubChem CID 102228587) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is 2-(2,3-dihydroxy-3-methylbutyl)-1,3,6-trihydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxyxanthen-9-one.
| Compound Name | 2-(2,3-dihydroxy-3-methylbutyl)-1,3,6-trihydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxyxanthen-9-one |
|---|---|
| PubChem CID | 102228587 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-(2,3-dihydroxy-3-methylbutyl)-1,3,6-trihydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxyxanthen-9-one |
| SMILES | COc1c(O)cc2oc3cc(O)c(CC(O)C(C)(C)O)c(O)c3c(=O)c2c1C/C=C(\C)CO |
| InChI | InChI=1S/C24H28O9/c1-11(10-25)5-6-12-19-16(9-15(27)23(12)32-4)33-17-8-14(26)13(7-18(28)24(2,3)31)21(29)20(17)22(19)30/h5,8-9,18,25-29,31H,6-7,10H2,1-4H3/b11-5+ |
| InChIKey | KXWWBRHUKRPZMD-VZUCSPMQSA-N |
| XLogP | 2.23 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|