C23H24O7 — CID 162859415
1,3,6,7-tetrahydroxy-2-[(2S)-2-hydroxy-3-methylbut-3-enyl]-8-(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 162859415) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 1,3,6,7-tetrahydroxy-2-[(2S)-2-hydroxy-3-methylbut-3-enyl]-8-(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 1,3,6,7-tetrahydroxy-2-[(2S)-2-hydroxy-3-methylbut-3-enyl]-8-(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 162859415 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1,3,6,7-tetrahydroxy-2-[(2S)-2-hydroxy-3-methylbut-3-enyl]-8-(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | C=C(C)[C@@H](O)Cc1c(O)cc2oc3cc(O)c(O)c(CC=C(C)C)c3c(=O)c2c1O |
| InChI | InChI=1S/C23H24O7/c1-10(2)5-6-12-19-17(9-16(26)21(12)27)30-18-8-15(25)13(7-14(24)11(3)4)22(28)20(18)23(19)29/h5,8-9,14,24-28H,3,6-7H2,1-2,4H3/t14-/m0/s1 |
| InChIKey | CIDJAUDKEZWBTC-AWEZNQCLSA-N |
| XLogP | 3.76 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|