C25H26O7 — CID 131676093
2-[3,4-dihydroxy-5-(2-hydroxy-3-methylbut-3-enyl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 131676093) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[3,4-dihydroxy-5-(2-hydroxy-3-methylbut-3-enyl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-[3,4-dihydroxy-5-(2-hydroxy-3-methylbut-3-enyl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 131676093 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[3,4-dihydroxy-5-(2-hydroxy-3-methylbut-3-enyl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | C=C(C)C(O)Cc1cc(-c2cc(=O)c3c(O)cc(O)c(CC=C(C)C)c3o2)cc(O)c1O |
| InChI | InChI=1S/C25H26O7/c1-12(2)5-6-16-18(27)10-19(28)23-20(29)11-22(32-25(16)23)14-7-15(9-17(26)13(3)4)24(31)21(30)8-14/h5,7-8,10-11,17,26-28,30-31H,3,6,9H2,1-2,4H3 |
| InChIKey | JPFJJMJUQCHCBQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|