C24H26O6 — CID 89405659
2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 89405659) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 89405659 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1cc(OC)cc(-c2cc(=O)c3c(OC)cc(OC)c(CC=C(C)C)c3o2)c1 |
| InChI | InChI=1S/C24H26O6/c1-14(2)7-8-18-21(28-5)13-22(29-6)23-19(25)12-20(30-24(18)23)15-9-16(26-3)11-17(10-15)27-4/h7,9-13H,8H2,1-6H3 |
| InChIKey | ATHUGPWSLFSXTF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|